2,4-Dichloro-6-(2-naphthalenyl)-1,3,5-triazine, 99%
cas: 112719-97-8 — see every product listed under this CAS number, including other names
2,4-Dichloro-6-(2-naphthalenyl)-1,3,5-triazine, 99% (CAS 112719-97-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 15g, 25g, 50g, 75g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch131K9M-1g |
| cas | 112719-97-8 |
| size | 1g |
| availability | 300g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 213.20 Pln | |
| Chemat | 10g | 357.20 Pln | |
| Chemat | 15g | 486.80 Pln | |
| Chemat | 25g | 669.20 Pln | |
| Chemat | 50g | 1221.20 Pln | |
| Chemat | 75g | 1778.00 Pln | |
| Chemat | 100g | 2296.40 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
2,4-dichloro-6-naphthalen-2-yl-1,3,5-triazine (CAS 112719-97-8) is a chemical compound with the molecular formula C13H7Cl2N3 and a molecular weight of 276.12 g/mol. IUPAC name: 2,4-dichloro-6-naphthalen-2-yl-1,3,5-triazine. InChIKey: ZAARQOHTIYBPNJ-UHFFFAOYSA-N.
| Molecular formula | C13H7Cl2N3 |
|---|---|
| Molecular weight | 276.12 g/mol |
| IUPAC name | 2,4-dichloro-6-naphthalen-2-yl-1,3,5-triazine |
| InChIKey | ZAARQOHTIYBPNJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=NC(=NC(=N3)Cl)Cl |
Computed by PubChem (NCBI)