cas: 1349718-98-4 — see every product listed under this CAS number, including other names
2,4-Dichloro-6-fluorobenzonitrile, 98%, 98% (CAS 1349718-98-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110YUE-100mg |
| cas | 1349718-98-4 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 717.20 Pln | |
| Chemat | 5g | 2800.40 Pln | |
| Chemat | 10g | 3726.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,4-dichloro-6-fluorobenzonitrile (CAS 1349718-98-4) is a chemical compound with the molecular formula C7H2Cl2FN and a molecular weight of 190.00 g/mol. IUPAC name: 2,4-dichloro-6-fluorobenzonitrile. InChIKey: HFZFDUUDVLMSPE-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2FN |
|---|---|
| Molecular weight | 190.00 g/mol |
| IUPAC name | 2,4-dichloro-6-fluorobenzonitrile |
| InChIKey | HFZFDUUDVLMSPE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C#N)Cl)Cl |
Computed by PubChem (NCBI)