cas: 1257651-49-2 — see every product listed under this CAS number, including other names
2,4-Dichloropyridine-3-boronic acid pinacol ester, 95%, 95% (CAS 1257651-49-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110IV9-250mg |
| cas | 1257651-49-2 |
| size | 250mg |
| availability | 4.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 664.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,4-dichloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1257651-49-2) is a chemical compound with the molecular formula C11H14BCl2NO2 and a molecular weight of 274.0 g/mol. IUPAC name: 2,4-dichloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: ZKIKGOMOMBWEOI-UHFFFAOYSA-N.
| Molecular formula | C11H14BCl2NO2 |
|---|---|
| Molecular weight | 274.0 g/mol |
| IUPAC name | 2,4-dichloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | ZKIKGOMOMBWEOI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CN=C2Cl)Cl |
Computed by PubChem (NCBI)