cas: 180059-04-5 — see every product listed under this CAS number, including other names
2,4-Dimethyl 3-amino-1H-pyrrole-2,4-dicarboxylate, ≥95%, ≥95% (CAS 180059-04-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1132NR-250mg |
| cas | 180059-04-5 |
| size | 250mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 400.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Dimethyl 3-amino-1H-pyrrole-2,4-dicarboxylate (CAS 180059-04-5) is a chemical compound with the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. IUPAC name: dimethyl 3-amino-1H-pyrrole-2,4-dicarboxylate. InChIKey: VFKYODDQOZLTQL-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O4 |
|---|---|
| Molecular weight | 198.18 g/mol |
| IUPAC name | dimethyl 3-amino-1H-pyrrole-2,4-dicarboxylate |
| InChIKey | VFKYODDQOZLTQL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CNC(=C1N)C(=O)OC |
Computed by PubChem (NCBI)