2,4-Dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiazole 98%
cas: 859833-13-9 — see every product listed under this CAS number, including other names
2,4-Dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiazole 98% (CAS 859833-13-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A513649-100mg |
| cas | 859833-13-9 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 275.81 Pln | |
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 2033.56 Pln | |
| Ambeed | 25g | 7507.06 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A513649 |
2,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (CAS 859833-13-9) is a chemical compound with the molecular formula C11H18BNO2S and a molecular weight of 239.15 g/mol. IUPAC name: 2,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole. InChIKey: AZYDPQHPHNHZPL-UHFFFAOYSA-N.
| Molecular formula | C11H18BNO2S |
|---|---|
| Molecular weight | 239.15 g/mol |
| IUPAC name | 2,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| InChIKey | AZYDPQHPHNHZPL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=C(S2)C)C |
Computed by PubChem (NCBI)
Synonyms:
2,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiazole, 2,4-Dimethylthiazole-5-boronic acid, pinacol ester, 2,4-dimethyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole, 2,4-Dimethylthiazole-5-boronic acid pinacol ester, Thiazole, 2,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, AZYDPQHPHNHZPL-UHFFFAOYSA-N, 2,4-Dimethylthiazole-5-boronic acid,pinacol ester, 2,4-dimethyl-thiazole-5-boronic acid pinacol ester, 2,4-dimethyl-1,3-thiazol-5-ylboronic acid pinacol ester, 2,4-Dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)