cas: 887686-65-9 — see every product listed under this CAS number, including other names
2,4-Dimethyl-6-(piperazin-1-yl)pyrimidine, 97%, 97% (CAS 887686-65-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11JC9D-100mg |
| cas | 887686-65-9 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 462.80 Pln | |
| Chemat | 1g | 1144.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,4-dimethyl-6-piperazin-1-ylpyrimidine (CAS 887686-65-9) is a chemical compound with the molecular formula C10H16N4 and a molecular weight of 192.26 g/mol. IUPAC name: 2,4-dimethyl-6-piperazin-1-ylpyrimidine. InChIKey: NARMKNJWXHFJFF-UHFFFAOYSA-N.
| Molecular formula | C10H16N4 |
|---|---|
| Molecular weight | 192.26 g/mol |
| IUPAC name | 2,4-dimethyl-6-piperazin-1-ylpyrimidine |
| InChIKey | NARMKNJWXHFJFF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)C)N2CCNCC2 |
Computed by PubChem (NCBI)