cas: 528-75-6 — see every product listed under this CAS number, including other names
2,4-Dinitrobenzaldehyde, 97% (CAS 528-75-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 1g, 100g, 500g. Offered by: Combi-blocks, Sigma-Aldrich, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | OR-2217-25g |
| cas | 528-75-6 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 100g | price on request | |
| Sigma-Aldrich | 1G | 143.00 Pln | |
| Sigma-Aldrich | 25G | 544.00 Pln | |
| Sigma-Aldrich | 5G | 257.00 Pln | |
| Fluorochem | 1g | 76.03 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 25g | 185.37 Pln | |
| Fluorochem | 100g | 508.17 Pln | |
| Fluorochem | 500g | 2257.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2,4-dinitrobenzaldehyde (CAS 528-75-6) is a chemical compound with the molecular formula C7H4N2O5 and a molecular weight of 196.12 g/mol. IUPAC name: 2,4-dinitrobenzaldehyde. InChIKey: ZILXIZUBLXVYPI-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O5 |
|---|---|
| Molecular weight | 196.12 g/mol |
| IUPAC name | 2,4-dinitrobenzaldehyde |
| InChIKey | ZILXIZUBLXVYPI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)