cas: 1269508-31-7 — see every product listed under this CAS number, including other names
2,4-Diphenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine, 97%, 97% (CAS 1269508-31-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250mg, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110IC1-1g |
| cas | 1269508-31-7 |
| size | 1g |
| availability | 1500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 179.60 Pln | |
| Chemat | 25g | 347.60 Pln | |
| Chemat | 50g | 578.00 Pln | |
| Chemat | 100g | 995.60 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 500g | 4459.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,4-diphenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine (CAS 1269508-31-7) is a chemical compound with the molecular formula C27H26BN3O2 and a molecular weight of 435.3 g/mol. IUPAC name: 2,4-diphenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine. InChIKey: FXHGBACNYDFALU-UHFFFAOYSA-N.
| Molecular formula | C27H26BN3O2 |
|---|---|
| Molecular weight | 435.3 g/mol |
| IUPAC name | 2,4-diphenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
| InChIKey | FXHGBACNYDFALU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C3=NC(=NC(=N3)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)