cas: 75427-75-7 — see every product listed under this CAS number, including other names
2,5,8,11,14,17,20-Heptaoxadocosan-22-oic acid, 97% (CAS 75427-75-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F867205-100MG |
| cas | 75427-75-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 143.72 Pln | |
| Fluorochem | 250mg | 200.99 Pln | |
| Fluorochem | 1g | 638.33 Pln | |
| Fluorochem | 5g | 2174.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (CAS 75427-75-7) is a chemical compound with the molecular formula C15H30O9 and a molecular weight of 354.39 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: AWSXISOALMMMQQ-UHFFFAOYSA-N.
| Molecular formula | C15H30O9 |
|---|---|
| Molecular weight | 354.39 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | AWSXISOALMMMQQ-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCC(=O)O |
Computed by PubChem (NCBI)