Products 366008-67-5

CAS 366008-67-5 appears in our catalog under these names: 2,5-Bis(trifluoromethyl)terephthalic acid, 95%, 2,5–Bis(trifluoromethyl)terephthalic acid, 2,5-Bis(trifluoromethyl)terephthalic Acid, >95.0%(GC)(T). Offered by: Combi-blocks, GLPBio, TCI, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g.

Structural formula: {0} (CAS {1})

2,5-bis(trifluoromethyl)terephthalic acid (CAS 366008-67-5) is a chemical compound with the molecular formula C10H4F6O4 and a molecular weight of 302.13 g/mol. IUPAC name: 2,5-bis(trifluoromethyl)terephthalic acid. InChIKey: YIAGLTIEICXRQF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H4F6O4
Molecular weight302.13 g/mol
IUPAC name2,5-bis(trifluoromethyl)terephthalic acid
InChIKeyYIAGLTIEICXRQF-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1C(F)(F)F)C(=O)O)C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)