CAS 63366-23-4 appears in our catalog under these names: 2,5–Bis(trimethylstannyl)furan, 2,5-bis(Trimethylstannyl)furan, 98%. Offered by: GLPBio, Fluorochem. Available pack sizes: 1g, 250mg.
Trimethyl-(5-trimethylstannylfuran-2-yl)stannane (CAS 63366-23-4) is a chemical compound with the molecular formula C10H20OSn2 and a molecular weight of 393.7 g/mol. IUPAC name: trimethyl-(5-trimethylstannylfuran-2-yl)stannane. InChIKey: LGLMAWUUKPRGBF-UHFFFAOYSA-N.
| Molecular formula | C10H20OSn2 |
|---|---|
| Molecular weight | 393.7 g/mol |
| IUPAC name | trimethyl-(5-trimethylstannylfuran-2-yl)stannane |
| InChIKey | LGLMAWUUKPRGBF-UHFFFAOYSA-N |
| SMILES | C[Sn](C)(C)C1=CC=C(O1)[Sn](C)(C)C |
Computed by PubChem (NCBI)