cas: 101421-19-6 — see every product listed under this CAS number, including other names
2,5-Dibromo-4-hydroxybenzoic acid, 98+% (CAS 101421-19-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A221604-10g |
| cas | 101421-19-6 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 17992.03 Pln | |
| AmBeed | 100mg | 851.20 Pln | |
| AmBeed | 1g | 4978.54 Pln | |
| AmBeed | 5g | 14880.25 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,5-dibromo-4-hydroxybenzoic acid (CAS 101421-19-6) is a chemical compound with the molecular formula C7H4Br2O3 and a molecular weight of 295.91 g/mol. IUPAC name: 2,5-dibromo-4-hydroxybenzoic acid. InChIKey: NDEWEMOLYCSDSE-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2O3 |
|---|---|
| Molecular weight | 295.91 g/mol |
| IUPAC name | 2,5-dibromo-4-hydroxybenzoic acid |
| InChIKey | NDEWEMOLYCSDSE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)O)Br)C(=O)O |
Computed by PubChem (NCBI)