cas: 514798-04-0 — see every product listed under this CAS number, including other names
2,5-Dichloro-3-fluoro-4-iodopyridine, 98% (CAS 514798-04-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A738885-10g |
| cas | 514798-04-0 |
| size | 10g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 8467.90 Pln | |
| AmBeed | 100mg | 642.88 Pln | |
| Fluorochem | 100mg | 430.07 Pln | |
| Fluorochem | 250mg | 679.99 Pln | |
| Fluorochem | 1g | 1299.56 Pln | |
| Fluorochem | 5g | 3397.78 Pln | |
| Fluorochem | 10g | 5443.93 Pln | |
| Chemat | 100mg | 294.80 Pln | |
| Chemat | 250mg | 467.60 Pln | |
| Chemat | 1g | 909.20 Pln | |
| Chemat | 5g | 2392.40 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,5-dichloro-3-fluoro-4-iodopyridine (CAS 514798-04-0) is a chemical compound with the molecular formula C5HCl2FIN and a molecular weight of 291.87 g/mol. IUPAC name: 2,5-dichloro-3-fluoro-4-iodopyridine. InChIKey: ZGDZUAKTVIRUKT-UHFFFAOYSA-N.
| Molecular formula | C5HCl2FIN |
|---|---|
| Molecular weight | 291.87 g/mol |
| IUPAC name | 2,5-dichloro-3-fluoro-4-iodopyridine |
| InChIKey | ZGDZUAKTVIRUKT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Cl)F)I)Cl |
Computed by PubChem (NCBI)