cas: 405230-81-1 — see every product listed under this CAS number, including other names
2,5-Dichloro-4-nitropyridine 1-oxide, 95+% (CAS 405230-81-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A953307-250mg |
| cas | 405230-81-1 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 597.31 Pln | |
| AmBeed | 25g | 7178.92 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,5-dichloro-4-nitro-1-oxidopyridin-1-ium (CAS 405230-81-1) is a chemical compound with the molecular formula C5H2Cl2N2O3 and a molecular weight of 208.98 g/mol. IUPAC name: 2,5-dichloro-4-nitro-1-oxidopyridin-1-ium. InChIKey: XXLFCBBWDXLUOK-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O3 |
|---|---|
| Molecular weight | 208.98 g/mol |
| IUPAC name | 2,5-dichloro-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | XXLFCBBWDXLUOK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C[N+](=C1Cl)[O-])Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)