cas: 280582-13-0 — see every product listed under this CAS number, including other names
2,5-Dichloro-N-(4-fluorophenyl)pyrimidin-4-amine, 95-<97% (CAS 280582-13-0) is a chemical reagent available from Chemat. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC1832-95-97-2.5g |
| cas | 280582-13-0 |
| size | 2,5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 2,5g | 4493.28 Pln | |
| Hoffman Fine Chemicals | 5g | 7868.30 Pln | |
| Hoffman Fine Chemicals | 10g | 12372.58 Pln | |
| Hoffman Fine Chemicals | 25g | 24430.78 Pln | |
| Hoffman Fine Chemicals | 50g | 38907.00 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
2,5-dichloro-N-(4-fluorophenyl)pyrimidin-4-amine (CAS 280582-13-0) is a chemical compound with the molecular formula C10H6Cl2FN3 and a molecular weight of 258.08 g/mol. IUPAC name: 2,5-dichloro-N-(4-fluorophenyl)pyrimidin-4-amine. InChIKey: XBRSOMKUVTXYSJ-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2FN3 |
|---|---|
| Molecular weight | 258.08 g/mol |
| IUPAC name | 2,5-dichloro-N-(4-fluorophenyl)pyrimidin-4-amine |
| InChIKey | XBRSOMKUVTXYSJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=NC(=NC=C2Cl)Cl)F |
Computed by PubChem (NCBI)