CAS 883973-99-7 appears in our catalog under these names: FBPase-1 inhibitor-1, 99%, 99%, FBPase-1 inhibitor-1, 99%, FBPase-1 Inhibitor, FBPase-1 inhibitor-1/ 99.91% (existing batch purity), Fructose 1,6–bisphosphatase–1 Inhibitor. Offered by: Chemat, Ambeed, TRC, TargetMol, GLPBio. Available pack sizes: 100mg, 250mg, 1g, 5mg, 10mg, 25mg, 50mg, 10 mg.
2,5-dichloro-N-(5-chloro-1,3-benzoxazol-2-yl)benzenesulfonamide (CAS 883973-99-7) is a chemical compound with the molecular formula C13H7Cl3N2O3S and a molecular weight of 377.6 g/mol. IUPAC name: 2,5-dichloro-N-(5-chloro-1,3-benzoxazol-2-yl)benzenesulfonamide. InChIKey: JCXZHFCBNFFHRC-UHFFFAOYSA-N.
| Molecular formula | C13H7Cl3N2O3S |
|---|---|
| Molecular weight | 377.6 g/mol |
| IUPAC name | 2,5-dichloro-N-(5-chloro-1,3-benzoxazol-2-yl)benzenesulfonamide |
| InChIKey | JCXZHFCBNFFHRC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N=C(O2)NS(=O)(=O)C3=C(C=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)