cas: 329930-90-7 — see every product listed under this CAS number, including other names
2,5-Dichloro-N-cyclohexylbenzamide (CAS 329930-90-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F751085-1G |
| cas | 329930-90-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 5173.20 Pln | |
| Fluorochem | 5g | 15383.14 Pln |
| delivery time | 3-4 weeks |
|---|
2,5-dichloro-N-cyclohexylbenzamide (CAS 329930-90-7) is a chemical compound with the molecular formula C13H15Cl2NO and a molecular weight of 272.17 g/mol. IUPAC name: 2,5-dichloro-N-cyclohexylbenzamide. InChIKey: VCWHZUNBXGXMIR-UHFFFAOYSA-N.
| Molecular formula | C13H15Cl2NO |
|---|---|
| Molecular weight | 272.17 g/mol |
| IUPAC name | 2,5-dichloro-N-cyclohexylbenzamide |
| InChIKey | VCWHZUNBXGXMIR-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)C2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)