CAS 956429-07-5 is the registry number for 2,5-Dimethoxy-4-methylphenylboronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
(2,5-dimethoxy-4-methylphenyl)boronic acid (CAS 956429-07-5) is a chemical compound with the molecular formula C9H13BO4 and a molecular weight of 196.01 g/mol. IUPAC name: (2,5-dimethoxy-4-methylphenyl)boronic acid. InChIKey: JKDJFKMOKNQPRW-UHFFFAOYSA-N.
| Molecular formula | C9H13BO4 |
|---|---|
| Molecular weight | 196.01 g/mol |
| IUPAC name | (2,5-dimethoxy-4-methylphenyl)boronic acid |
| InChIKey | JKDJFKMOKNQPRW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OC)C)OC)(O)O |
Computed by PubChem (NCBI)