Products 636-44-2

CAS 636-44-2 appears in our catalog under these names: 2,5–Dimethyl–3–furancarboxylic Acid, 2,5-Dimethyl-3-furancarboxylic Acid, >98.0%(GC)(T), 2,5-DIMETHYL-3-FUROIC ACID, 98%, 2,5-Dimethylfuran-3-carboxylic acid, 98%, 98%, 2,5-Dimethylfuran-3-carboxylic acid, 98%. Offered by: GLPBio, TCI, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 10g, 250mg.

Structural formula: {0} (CAS {1})

2,5-dimethylfuran-3-carboxylic acid (CAS 636-44-2) is a chemical compound with the molecular formula C7H8O3 and a molecular weight of 140.14 g/mol. IUPAC name: 2,5-dimethylfuran-3-carboxylic acid. InChIKey: CNTHHNPBADVTRY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8O3
Molecular weight140.14 g/mol
IUPAC name2,5-dimethylfuran-3-carboxylic acid
InChIKeyCNTHHNPBADVTRY-UHFFFAOYSA-N
SMILESCC1=CC(=C(O1)C)C(=O)O

Computed by PubChem (NCBI)