cas: 169751-10-4 — see every product listed under this CAS number, including other names
2,5-Dioxo-1-((6-(3-(pyridin-2-yldisulfaneyl)propanamido)hexanoyl)oxy)pyrrolidine-3-sulfonic acid, sodium salt, 95% (CAS 169751-10-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A2749255-100mg |
| cas | 169751-10-4 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 16572.85 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Sodium 2,5-dioxo-1-[6-[3-(pyridin-2-yldisulfanyl)propanoylamino]hexanoyloxy]pyrrolidine-3-sulfonate (CAS 169751-10-4) is a chemical compound with the molecular formula C18H22N3NaO8S3 and a molecular weight of 527.6 g/mol. IUPAC name: sodium 2,5-dioxo-1-[6-[3-(pyridin-2-yldisulfanyl)propanoylamino]hexanoyloxy]pyrrolidine-3-sulfonate. InChIKey: ZAPNXDUFCQIHFS-UHFFFAOYSA-M.
| Molecular formula | C18H22N3NaO8S3 |
|---|---|
| Molecular weight | 527.6 g/mol |
| IUPAC name | sodium 2,5-dioxo-1-[6-[3-(pyridin-2-yldisulfanyl)propanoylamino]hexanoyloxy]pyrrolidine-3-sulfonate |
| InChIKey | ZAPNXDUFCQIHFS-UHFFFAOYSA-M |
| SMILES | C1C(C(=O)N(C1=O)OC(=O)CCCCCNC(=O)CCSSC2=CC=CC=N2)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)