cas: 150408-83-6 — see every product listed under this CAS number, including other names
2,5-Dioxo-1-pyrrolidinyl 3',6'-bis(dimethylamino)-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthene]-ar-carboxylate (CAS 150408-83-6) is a chemical reagent available from Chemat. Available pack sizes: 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112ML0-25mg |
| cas | 150408-83-6 |
| size | 25mg |
| availability | 0.025g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 3957.20 Pln |
| delivery time | 3 weeks |
|---|
(2,5-dioxopyrrolidin-1-yl) 3',6'-bis(dimethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylate (CAS 150408-83-6) is a chemical compound with the molecular formula C29H25N3O7 and a molecular weight of 527.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3',6'-bis(dimethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylate. InChIKey: CXYYHBMOVJJZTD-UHFFFAOYSA-N.
| Molecular formula | C29H25N3O7 |
|---|---|
| Molecular weight | 527.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3',6'-bis(dimethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylate |
| InChIKey | CXYYHBMOVJJZTD-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C3(C4=C(C=C(C=C4)C(=O)ON5C(=O)CCC5=O)C(=O)O3)C6=C(O2)C=C(C=C6)N(C)C |
Computed by PubChem (NCBI)