cas: 1818294-32-4 — see every product listed under this CAS number, including other names
2,5-Dioxo-1-pyrrolidinyl 3-[[19-oxo-21-(2-pyridinyldithio)-3,6,9,12,15-pentaoxa-18-azaheneicos-1-yl]oxy]propanoate, 95%, 95% (CAS 1818294-32-4) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I1BU-25mg |
| cas | 1818294-32-4 |
| size | 25mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 534.80 Pln | |
| Chemat | 50mg | 938.00 Pln | |
| Chemat | 100mg | 1302.80 Pln | |
| Chemat | 250mg | 2310.80 Pln | |
| Chemat | 1g | 7259.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[3-(pyridin-2-yldisulfanyl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1818294-32-4) is a chemical compound with the molecular formula C27H41N3O11S2 and a molecular weight of 647.8 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[3-(pyridin-2-yldisulfanyl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: KOEOEXUDNQGULJ-UHFFFAOYSA-N.
| Molecular formula | C27H41N3O11S2 |
|---|---|
| Molecular weight | 647.8 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[3-(pyridin-2-yldisulfanyl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | KOEOEXUDNQGULJ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCOCCOCCNC(=O)CCSSC2=CC=CC=N2 |
Computed by PubChem (NCBI)