cas: 441349-04-8 — see every product listed under this CAS number, including other names
2,5-Dioxo-1-pyrrolidinyl 7-[[(1,1-dimethylethoxy)carbonyl]amino]heptanoate, 97%, 97% (CAS 441349-04-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12NUXP-100mg |
| cas | 441349-04-8 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 1029.20 Pln | |
| Chemat | 1g | 1715.60 Pln | |
| Chemat | 5g | 4888.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 7-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoate (CAS 441349-04-8) is a chemical compound with the molecular formula C16H26N2O6 and a molecular weight of 342.39 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 7-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoate. InChIKey: ZFUOZXGXWKTKGY-UHFFFAOYSA-N.
| Molecular formula | C16H26N2O6 |
|---|---|
| Molecular weight | 342.39 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 7-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoate |
| InChIKey | ZFUOZXGXWKTKGY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)