cas: 66065-85-8 — see every product listed under this CAS number, including other names
2,5-Dioxopyrrolidin-1-yl (2,2,2-trichloroethyl) carbonate, 95% (CAS 66065-85-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F229997-1G |
| cas | 66065-85-8 |
| size | 1g |
| availability | In Stock UK |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 195.78 Pln | |
| Fluorochem | 25g | 357.18 Pln | |
| Fluorochem | 100g | 1164.19 Pln | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 203.50 Pln | |
| Ambeed | 25g | 392.62 Pln | |
| Ambeed | 100g | 1354.94 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
(2,5-dioxopyrrolidin-1-yl) 2,2,2-trichloroethyl carbonate (CAS 66065-85-8) is a chemical compound with the molecular formula C7H6Cl3NO5 and a molecular weight of 290.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2,2,2-trichloroethyl carbonate. InChIKey: WBZXNGAFYBGQFE-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl3NO5 |
|---|---|
| Molecular weight | 290.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2,2,2-trichloroethyl carbonate |
| InChIKey | WBZXNGAFYBGQFE-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)OCC(Cl)(Cl)Cl |
Computed by PubChem (NCBI)