cas: 487-27-4 — see every product listed under this CAS number, including other names
2,5-Methano-2H-furo[3,2-b]pyrrol-6-ol, hexahydro-4-methyl-, (2R,3aS,5R,6R,6aR)-rel-, ≥98%, ≥98% (CAS 487-27-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DLS2-100mg |
| cas | 487-27-4 |
| size | 100mg |
| availability | 0.3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 458.00 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
(1S,3S,4S,5S,7R)-6-methyl-2-oxa-6-azatricyclo[3.3.1.03,7]nonan-4-ol (CAS 487-27-4) is a chemical compound with the molecular formula C8H13NO2 and a molecular weight of 155.19 g/mol. IUPAC name: (1S,3S,4S,5S,7R)-6-methyl-2-oxa-6-azatricyclo[3.3.1.03,7]nonan-4-ol. InChIKey: MEGPURSNXMUDAE-RLMOJYMMSA-N.
| Molecular formula | C8H13NO2 |
|---|---|
| Molecular weight | 155.19 g/mol |
| IUPAC name | (1S,3S,4S,5S,7R)-6-methyl-2-oxa-6-azatricyclo[3.3.1.03,7]nonan-4-ol |
| InChIKey | MEGPURSNXMUDAE-RLMOJYMMSA-N |
| SMILES | CN1[C@H]2C[C@H]3C[C@@H]1[C@@H]([C@H]2O)O3 |
Computed by PubChem (NCBI)