cas: 4282-31-9 — see every product listed under this CAS number, including other names
2,5-Thiophenedicarboxylic Acid, >98.0%(GC)(T) (CAS 4282-31-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T2347-5G |
| cas | 4282-31-9 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 147.85 Pln | |
| TCI | 25g | 423.21 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
Thiophene-2,5-dicarboxylic acid (CAS 4282-31-9) is a chemical compound with the molecular formula C6H4O4S and a molecular weight of 172.16 g/mol. IUPAC name: thiophene-2,5-dicarboxylic acid. InChIKey: YCGAZNXXGKTASZ-UHFFFAOYSA-N.
| Molecular formula | C6H4O4S |
|---|---|
| Molecular weight | 172.16 g/mol |
| IUPAC name | thiophene-2,5-dicarboxylic acid |
| InChIKey | YCGAZNXXGKTASZ-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)