2,6,10,15,19,23-Hexamethyltetracosane, 98%, 98%
cas: 111-01-3 — see every product listed under this CAS number, including other names
2,6,10,15,19,23-Hexamethyltetracosane, 98%, 98% (CAS 111-01-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1146M7-1g |
| cas | 111-01-3 |
| size | 1g |
| availability | 214.24g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 98.00 Pln | |
| Chemat | 50g | 122.00 Pln | |
| Chemat | 100g | 170.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,6,10,15,19,23-hexamethyltetracosane (CAS 111-01-3) is a chemical compound with the molecular formula C30H62 and a molecular weight of 422.8 g/mol. IUPAC name: 2,6,10,15,19,23-hexamethyltetracosane. InChIKey: PRAKJMSDJKAYCZ-UHFFFAOYSA-N.
| Molecular formula | C30H62 |
|---|---|
| Molecular weight | 422.8 g/mol |
| IUPAC name | 2,6,10,15,19,23-hexamethyltetracosane |
| InChIKey | PRAKJMSDJKAYCZ-UHFFFAOYSA-N |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCCC(C)CCCC(C)CCCC(C)C |
Computed by PubChem (NCBI)