CAS 73892-45-2 appears in our catalog under these names: 2,6-Bis((diphenylphosphanyl)methyl)pyridine, 97%, 97%, 2,6-Bis((diphenylphosphanyl)methyl)pyridine, 97%. Offered by: Chemat, Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
[6-(diphenylphosphanylmethyl)-2-pyridinyl]methyl-diphenylphosphane (CAS 73892-45-2) is a chemical compound with the molecular formula C31H27NP2 and a molecular weight of 475.5 g/mol. IUPAC name: [6-(diphenylphosphanylmethyl)-2-pyridinyl]methyl-diphenylphosphane. InChIKey: DTLGEJJDCXCJPC-UHFFFAOYSA-N.
| Molecular formula | C31H27NP2 |
|---|---|
| Molecular weight | 475.5 g/mol |
| IUPAC name | [6-(diphenylphosphanylmethyl)-2-pyridinyl]methyl-diphenylphosphane |
| InChIKey | DTLGEJJDCXCJPC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(CC2=NC(=CC=C2)CP(C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)