cas: 455-00-5 — see every product listed under this CAS number, including other names
2,6-Bis(trifluoromethyl)pyridine 97% (CAS 455-00-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A452137-1g |
| cas | 455-00-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 25g | 1143.56 Pln | |
| Ambeed | 100g | 3507.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A452137 |
2,6-bis(trifluoromethyl)pyridine (CAS 455-00-5) is a chemical compound with the molecular formula C7H3F6N and a molecular weight of 215.10 g/mol. IUPAC name: 2,6-bis(trifluoromethyl)pyridine. InChIKey: YPDVFTXBESQIPJ-UHFFFAOYSA-N.
| Molecular formula | C7H3F6N |
|---|---|
| Molecular weight | 215.10 g/mol |
| IUPAC name | 2,6-bis(trifluoromethyl)pyridine |
| InChIKey | YPDVFTXBESQIPJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)