cas: 118754-55-5 — see every product listed under this CAS number, including other names
2,6-DICHLORO-4-(TRIFLUOROMETHOXY)BROMOBENZENE (CAS 118754-55-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F474835-5G |
| cas | 118754-55-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1237.08 Pln | |
| Fluorochem | 10g | 2059.71 Pln |
| delivery time | 3-4 weeks |
|---|
2-bromo-1,3-dichloro-5-(trifluoromethoxy)benzene (CAS 118754-55-5) is a chemical compound with the molecular formula C7H2BrCl2F3O and a molecular weight of 309.89 g/mol. IUPAC name: 2-bromo-1,3-dichloro-5-(trifluoromethoxy)benzene. InChIKey: CAAJZKZQEJSRJO-UHFFFAOYSA-N.
| Molecular formula | C7H2BrCl2F3O |
|---|---|
| Molecular weight | 309.89 g/mol |
| IUPAC name | 2-bromo-1,3-dichloro-5-(trifluoromethoxy)benzene |
| InChIKey | CAAJZKZQEJSRJO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)Br)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)