cas: 72678-19-4 — see every product listed under this CAS number, including other names
2,6-Dibromo-4-(trifluoromethyl)aniline 98+% (CAS 72678-19-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1481654-5g |
| cas | 72678-19-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 648.50 Pln | |
| Ambeed | 500g | 1955.69 Pln |
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1481654 |
2,6-dibromo-4-(trifluoromethyl)aniline (CAS 72678-19-4) is a chemical compound with the molecular formula C7H4Br2F3N and a molecular weight of 318.92 g/mol. IUPAC name: 2,6-dibromo-4-(trifluoromethyl)aniline. InChIKey: DRSMEHXBOXHXDX-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2F3N |
|---|---|
| Molecular weight | 318.92 g/mol |
| IUPAC name | 2,6-dibromo-4-(trifluoromethyl)aniline |
| InChIKey | DRSMEHXBOXHXDX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)N)Br)C(F)(F)F |
Computed by PubChem (NCBI)