CAS 1415560-29-0 appears in our catalog under these names: Pyrido[2,3-d]pyrimidin-7(8H)-one, 2,6-dibromo-8-cyclopentyl-5-methyl-, 97%, 97%, 2,6-Dibromo-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7(8H)-one, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2,6-dibromo-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one (CAS 1415560-29-0) is a chemical compound with the molecular formula C13H13Br2N3O and a molecular weight of 387.07 g/mol. IUPAC name: 2,6-dibromo-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one. InChIKey: GDBOCEQMRZFVCK-UHFFFAOYSA-N.
| Molecular formula | C13H13Br2N3O |
|---|---|
| Molecular weight | 387.07 g/mol |
| IUPAC name | 2,6-dibromo-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one |
| InChIKey | GDBOCEQMRZFVCK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(C2=NC(=NC=C12)Br)C3CCCC3)Br |
Computed by PubChem (NCBI)