cas: 157021-61-9 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-(trifluoromethyl)benzonitrile (CAS 157021-61-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F004744-1G |
| cas | 157021-61-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 7510.91 Pln | |
| Fluorochem | 250mg | 2757.38 Pln |
| delivery time | 2-3 weeks |
|---|
2,6-dichloro-4-(trifluoromethyl)benzonitrile (CAS 157021-61-9) is a chemical compound with the molecular formula C8H2Cl2F3N and a molecular weight of 240.01 g/mol. IUPAC name: 2,6-dichloro-4-(trifluoromethyl)benzonitrile. InChIKey: NCXSSFQXQAOREM-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl2F3N |
|---|---|
| Molecular weight | 240.01 g/mol |
| IUPAC name | 2,6-dichloro-4-(trifluoromethyl)benzonitrile |
| InChIKey | NCXSSFQXQAOREM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C#N)Cl)C(F)(F)F |
Computed by PubChem (NCBI)