cas: 2587-01-1 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-nitropyridine-N-oxide, 96%(GC-MS),RG, 96%(GC-MS),RG (CAS 2587-01-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114G42-100mg |
| cas | 2587-01-1 |
| size | 100mg |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 506.00 Pln | |
| Chemat | 25g | 2200.40 Pln |
| purity | 96%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
2,6-dichloro-4-nitro-1-oxidopyridin-1-ium (CAS 2587-01-1) is a chemical compound with the molecular formula C5H2Cl2N2O3 and a molecular weight of 208.98 g/mol. IUPAC name: 2,6-dichloro-4-nitro-1-oxidopyridin-1-ium. InChIKey: LWOLKOLHQCMQDE-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O3 |
|---|---|
| Molecular weight | 208.98 g/mol |
| IUPAC name | 2,6-dichloro-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | LWOLKOLHQCMQDE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C([N+](=C1Cl)[O-])Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)