CAS 151229-84-4 appears in our catalog under these names: 2,6-Dichloropyridine-3,5-dicarbonitrile, 95%, 2,6-dichloropyridine-3,5-dicarbonitrile, 98%, 98%, 2,6-Dichloropyridine-3,5-dicarbonitrile, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
2,6-dichloropyridine-3,5-dicarbonitrile (CAS 151229-84-4) is a chemical compound with the molecular formula C7HCl2N3 and a molecular weight of 198.01 g/mol. IUPAC name: 2,6-dichloropyridine-3,5-dicarbonitrile. InChIKey: JWVLIQKMDXWUFT-UHFFFAOYSA-N.
| Molecular formula | C7HCl2N3 |
|---|---|
| Molecular weight | 198.01 g/mol |
| IUPAC name | 2,6-dichloropyridine-3,5-dicarbonitrile |
| InChIKey | JWVLIQKMDXWUFT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1C#N)Cl)Cl)C#N |
Computed by PubChem (NCBI)