cas: 3335-46-4 — see every product listed under this CAS number, including other names
2,6-Dihydroxy-4-(trifluoromethyl)nicotinonitrile 95% (CAS 3335-46-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A102616-1g |
| cas | 3335-46-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 236.88 Pln | |
| Ambeed | 10g | 331.44 Pln | |
| Ambeed | 25g | 648.50 Pln | |
| Ambeed | 100g | 1299.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A102616 |
2-hydroxy-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carbonitrile (CAS 3335-46-4) is a chemical compound with the molecular formula C7H3F3N2O2 and a molecular weight of 204.11 g/mol. IUPAC name: 2-hydroxy-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carbonitrile. InChIKey: JRLZWXISQMMITA-UHFFFAOYSA-N.
| Molecular formula | C7H3F3N2O2 |
|---|---|
| Molecular weight | 204.11 g/mol |
| IUPAC name | 2-hydroxy-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carbonitrile |
| InChIKey | JRLZWXISQMMITA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(NC1=O)O)C#N)C(F)(F)F |
Computed by PubChem (NCBI)