2,7,12-Tribromo-5,5,10,10,15,15-hexahexyl-10,15-dihydro-5H-diindeno[1,2-a:1',2'-c]fluorene, 99%
cas: 600172-86-9 — see every product listed under this CAS number, including other names
2,7,12-Tribromo-5,5,10,10,15,15-hexahexyl-10,15-dihydro-5H-diindeno[1,2-a:1',2'-c]fluorene, 99% (CAS 600172-86-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1156400-250mg |
| cas | 600172-86-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 776.44 Pln | |
| Ambeed | 1g | 2183.75 Pln | |
| Ambeed | 5g | 7089.88 Pln | |
| Chemat | 100mg | 357.20 Pln | |
| Chemat | 250mg | 688.40 Pln | |
| Chemat | 1g | 1941.20 Pln | |
| BLDpharm | 100mg | 403.22 Pln | |
| BLDpharm | 250mg | 758.65 Pln | |
| BLDpharm | 1g | 2141.49 Pln | |
| BLDpharm | 5g | 6950.91 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
6,15,24-tribromo-9,9,18,18,27,27-hexahexylheptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3(8),4,6,10,12(17),13,15,19,21(26),22,24-dodecaene (CAS 600172-86-9) is a chemical compound with the molecular formula C63H87Br3 and a molecular weight of 1084.1 g/mol. IUPAC name: 6,15,24-tribromo-9,9,18,18,27,27-hexahexylheptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3(8),4,6,10,12(17),13,15,19,21(26),22,24-dodecaene. InChIKey: CTEMXYJSIVXXEX-UHFFFAOYSA-N.
| Molecular formula | C63H87Br3 |
|---|---|
| Molecular weight | 1084.1 g/mol |
| IUPAC name | 6,15,24-tribromo-9,9,18,18,27,27-hexahexylheptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3(8),4,6,10,12(17),13,15,19,21(26),22,24-dodecaene |
| InChIKey | CTEMXYJSIVXXEX-UHFFFAOYSA-N |
| SMILES | CCCCCCC1(C2=C(C=CC(=C2)Br)C3=C4C(=C5C(=C31)C6=C(C5(CCCCCC)CCCCCC)C=C(C=C6)Br)C7=C(C4(CCCCCC)CCCCCC)C=C(C=C7)Br)CCCCCC |
Computed by PubChem (NCBI)