cas: 14897-39-3 — see every product listed under this CAS number, including other names
2,7-(Epoxypentadeca[1,11,13]trienimino)naphtho[2,1-b]furan-1,11(2H)-dione, 5,6,9,17,19,21-hexahydroxy-23-methoxy-2,4,12,16,18,20,22-heptamethyl-, 21-acetate, sodium salt, 97%, 97% (CAS 14897-39-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112LAU-1g |
| cas | 14897-39-3 |
| size | 1g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 25g | 477.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Sodium (7S,9E,11S,12R,13S,14R,15R,16R,17S,18S,19E,21Z)-13-acetyloxy-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-27-olate (CAS 14897-39-3) is a chemical compound with the molecular formula C37H46NNaO12 and a molecular weight of 719.7 g/mol. IUPAC name: sodium (7S,9E,11S,12R,13S,14R,15R,16R,17S,18S,19E,21Z)-13-acetyloxy-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-27-olate. InChIKey: YVOFSHPIJOYKSH-NLYBMVFSSA-M.
| Molecular formula | C37H46NNaO12 |
|---|---|
| Molecular weight | 719.7 g/mol |
| IUPAC name | sodium (7S,9E,11S,12R,13S,14R,15R,16R,17S,18S,19E,21Z)-13-acetyloxy-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-27-olate |
| InChIKey | YVOFSHPIJOYKSH-NLYBMVFSSA-M |
| SMILES | C[C@H]1/C=C/C=C(\C(=O)NC2=CC(=C3C(=C2O)C(=C(C4=C3C(=O)[C@](O4)(O/C=C/[C@@H]([C@H]([C@H]([C@@H]([C@@H]([C@@H]([C@H]1O)C)O)C)OC(=O)C)C)OC)C)C)O)[O-])/C.[Na+] |
Computed by PubChem (NCBI)