2,7-Bis((1R,2R)-2-aminocyclohexyl)benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetraone, 95%
cas: 906371-28-6 — see every product listed under this CAS number, including other names
2,7-Bis((1R,2R)-2-aminocyclohexyl)benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetraone, 95% (CAS 906371-28-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1617726-250mg |
| cas | 906371-28-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1393.88 Pln | |
| Ambeed | 1g | 4024.94 Pln | |
| Chemat | 50mg | 472.40 Pln | |
| Chemat | 100mg | 760.40 Pln | |
| Chemat | 250mg | 1245.20 Pln | |
| Chemat | 1g | 3606.80 Pln | |
| BLDpharm | 50mg | 514.29 Pln | |
| BLDpharm | 100mg | 869.72 Pln | |
| BLDpharm | 250mg | 1363.99 Pln | |
| BLDpharm | 1g | 3946.41 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6,13-bis[(1R,2R)-2-aminocyclohexyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (CAS 906371-28-6) is a chemical compound with the molecular formula C26H28N4O4 and a molecular weight of 460.5 g/mol. IUPAC name: 6,13-bis[(1R,2R)-2-aminocyclohexyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone. InChIKey: RERDXPKEIRVWQC-UAFMIMERSA-N.
| Molecular formula | C26H28N4O4 |
|---|---|
| Molecular weight | 460.5 g/mol |
| IUPAC name | 6,13-bis[(1R,2R)-2-aminocyclohexyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| InChIKey | RERDXPKEIRVWQC-UAFMIMERSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)N)N2C(=O)C3=C4C(=CC=C5C4=C(C=C3)C(=O)N(C5=O)[C@@H]6CCCC[C@H]6N)C2=O |
Computed by PubChem (NCBI)