cas: 1138220-69-5 — see every product listed under this CAS number, including other names
2,7-Bis[N,N-bis(4-methoxyphenyl)amino]9,9-spiro-bifluorene, 98.0%, 98.0% (CAS 1138220-69-5) is a chemical reagent available from Chemat. Available pack sizes: 200mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1104S0-200mg |
| cas | 1138220-69-5 |
| size | 200mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 405.20 Pln |
| purity | 98.0% |
|---|---|
| delivery time | 3 weeks |
2-N',2-N',7-N',7-N'-tetrakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2',7'-diamine (CAS 1138220-69-5) is a chemical compound with the molecular formula C53H42N2O4 and a molecular weight of 770.9 g/mol. IUPAC name: 2-N',2-N',7-N',7-N'-tetrakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2',7'-diamine. InChIKey: LZHVTCXAXYYCIF-UHFFFAOYSA-N.
| Molecular formula | C53H42N2O4 |
|---|---|
| Molecular weight | 770.9 g/mol |
| IUPAC name | 2-N',2-N',7-N',7-N'-tetrakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2',7'-diamine |
| InChIKey | LZHVTCXAXYYCIF-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N(C2=CC=C(C=C2)OC)C3=CC4=C(C=C3)C5=C(C46C7=CC=CC=C7C8=CC=CC=C68)C=C(C=C5)N(C9=CC=C(C=C9)OC)C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)