CAS 58775-05-6 appears in our catalog under these names: 2,7–Di–tert–butylfluorene, 2,7-Di-tert-butylfluorene, 97+% , 2,7-Di-tert-butylfluorene, >98.0%(GC), 2,7-Di-tert-butylfluorene 98%, 2,7-Di-tert-butylfluorene, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 5g, 25g, 1000g, 10g, 500g, 1kg, 1g.
2,7-ditert-butyl-9H-fluorene (CAS 58775-05-6) is a chemical compound with the molecular formula C21H26 and a molecular weight of 278.4 g/mol. IUPAC name: 2,7-ditert-butyl-9H-fluorene. InChIKey: DFZYPLLGAQIQTD-UHFFFAOYSA-N.
| Molecular formula | C21H26 |
|---|---|
| Molecular weight | 278.4 g/mol |
| IUPAC name | 2,7-ditert-butyl-9H-fluorene |
| InChIKey | DFZYPLLGAQIQTD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)C3=C(C2)C=C(C=C3)C(C)(C)C |
Computed by PubChem (NCBI)