cas: 157771-56-7 — see every product listed under this CAS number, including other names
2,7-Dibromo-9,9-dipropyl-9H-fluorene (CAS 157771-56-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 200mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112PP7-250mg |
| cas | 157771-56-7 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 1029.20 Pln | |
| Chemat | 200mg | 126.80 Pln |
| delivery time | 3 weeks |
|---|
2,7-dibromo-9,9-dipropylfluorene (CAS 157771-56-7) is a chemical compound with the molecular formula C19H20Br2 and a molecular weight of 408.2 g/mol. IUPAC name: 2,7-dibromo-9,9-dipropylfluorene. InChIKey: QQTBEFPDRHYPLE-UHFFFAOYSA-N.
| Molecular formula | C19H20Br2 |
|---|---|
| Molecular weight | 408.2 g/mol |
| IUPAC name | 2,7-dibromo-9,9-dipropylfluorene |
| InChIKey | QQTBEFPDRHYPLE-UHFFFAOYSA-N |
| SMILES | CCCC1(C2=C(C=CC(=C2)Br)C3=C1C=C(C=C3)Br)CCC |
Computed by PubChem (NCBI)