2,7-Dibromo-9-phenyl-9H-carbazole, 95%
cas: 444796-09-2 — see every product listed under this CAS number, including other names
2,7-Dibromo-9-phenyl-9H-carbazole, 95% (CAS 444796-09-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg, 100g. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A100433-250mg |
| cas | 444796-09-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 275.81 Pln | |
| Ambeed | 10g | 431.56 Pln | |
| Ambeed | 25g | 960.00 Pln | |
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 189.20 Pln | |
| Chemat | 10g | 314.00 Pln | |
| Chemat | 25g | 693.20 Pln | |
| Chemat | 100g | 1984.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2,7-dibromo-9-phenylcarbazole (CAS 444796-09-2) is a chemical compound with the molecular formula C18H11Br2N and a molecular weight of 401.1 g/mol. IUPAC name: 2,7-dibromo-9-phenylcarbazole. InChIKey: MDXCDMSVFQIDGN-UHFFFAOYSA-N.
| Molecular formula | C18H11Br2N |
|---|---|
| Molecular weight | 401.1 g/mol |
| IUPAC name | 2,7-dibromo-9-phenylcarbazole |
| InChIKey | MDXCDMSVFQIDGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=CC(=C3)Br)C4=C2C=C(C=C4)Br |
Computed by PubChem (NCBI)