CAS 31551-45-8 appears in our catalog under these names: 2,7–Dinitro–9–fluorenone, 2,7-Dinitro-9-fluorenone, 97% , 2,7-Dinitro-9-fluorenone, >98.0%(HPLC)(N), 2,7-Dinitro-9-fluorenone 95%, 2,7-Dinitro-9-fluorenone, 95%, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g, 250g, 100mg, 250mg, 1g, 10g.
2,7-dinitrofluoren-9-one (CAS 31551-45-8) is a chemical compound with the molecular formula C13H6N2O5 and a molecular weight of 270.20 g/mol. IUPAC name: 2,7-dinitrofluoren-9-one. InChIKey: HDVGAFBXTXDYIB-UHFFFAOYSA-N.
| Molecular formula | C13H6N2O5 |
|---|---|
| Molecular weight | 270.20 g/mol |
| IUPAC name | 2,7-dinitrofluoren-9-one |
| InChIKey | HDVGAFBXTXDYIB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=O)C3=C2C=CC(=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)