cas: 3613-73-8 — see every product listed under this CAS number, including other names
2,8-Dimethyl-5-(2-(6-methylpyridin-3-yl)ethyl)-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole, 98%, 98% (CAS 3613-73-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I86J-25mg |
| cas | 3613-73-8 |
| size | 25mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 443.60 Pln | |
| Chemat | 50mg | 712.40 Pln | |
| Chemat | 100mg | 1168.40 Pln | |
| Chemat | 250mg | 1941.20 Pln | |
| Chemat | 1g | 5133.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Latrepirdine is a member of methylpyridines and a pyridoindole. It has a role as a geroprotector.
Source: ChEBI
| Molecular formula | C21H25N3 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole |
| InChIKey | JNODQFNWMXFMEV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(C3=C2CN(CC3)C)CCC4=CN=C(C=C4)C |
Computed by PubChem (NCBI)