cas: 842133-80-6 — see every product listed under this CAS number, including other names
2–Chloro–5–((2S,3S,4R,5R,6R)–3,4,5–tris(benzyloxy)–6–((benzyloxy)methyl)oxan–2–yl)benzoic acid (CAS 842133-80-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g, 1g, 250mg, 500mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB54525-100 |
| cas | 842133-80-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 1182.10 Pln | |
| GLPBio | 10g | 15729.10 Pln | |
| GLPBio | 1g | 3475.55 Pln | |
| GLPBio | 250mg | 1640.79 Pln | |
| GLPBio | 500mg | 2455.20 Pln | |
| GLPBio | 5g | 9602.32 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]benzoic acid (CAS 842133-80-6) is a chemical compound with the molecular formula C41H39ClO7 and a molecular weight of 679.2 g/mol. IUPAC name: 2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]benzoic acid. InChIKey: AHASAGYREFLQPR-CSISHVCHSA-N.
| Molecular formula | C41H39ClO7 |
|---|---|
| Molecular weight | 679.2 g/mol |
| IUPAC name | 2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]benzoic acid |
| InChIKey | AHASAGYREFLQPR-CSISHVCHSA-N |
| SMILES | C1=CC=C(C=C1)COC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)C3=CC(=C(C=C3)Cl)C(=O)O)OCC4=CC=CC=C4)OCC5=CC=CC=C5)OCC6=CC=CC=C6 |
Computed by PubChem (NCBI)