cas: 29108-90-5 — see every product listed under this CAS number, including other names
2’,3’-Di-O-acetyluridine (CAS 29108-90-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 50mg, 100mg, 500mg. Offered by: TargetMol.
| brand | TargetMol |
|---|---|
| catalog number | TNU1572-1g |
| cas | 29108-90-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1g | 2471.22 Pln | |
| TargetMol | 5g | 5233.80 Pln | |
| TargetMol | 50mg | 638.26 Pln | |
| TargetMol | 100mg | 890.92 Pln | |
| TargetMol | 500mg | 1714.33 Pln |
| purity | No data |
|---|---|
| delivery time | approx. 33 days |
[(2R,3R,4R,5R)-4-acetyloxy-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] acetate (CAS 29108-90-5) is a chemical compound with the molecular formula C13H16N2O8 and a molecular weight of 328.27 g/mol. IUPAC name: [(2R,3R,4R,5R)-4-acetyloxy-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] acetate. InChIKey: BUHMZKLSFGZBHP-HJQYOEGKSA-N.
| Molecular formula | C13H16N2O8 |
|---|---|
| Molecular weight | 328.27 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-4-acetyloxy-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] acetate |
| InChIKey | BUHMZKLSFGZBHP-HJQYOEGKSA-N |
| SMILES | CC(=O)O[C@@H]1[C@H](O[C@H]([C@@H]1OC(=O)C)N2C=CC(=O)NC2=O)CO |
Computed by PubChem (NCBI)