cas: 90986-10-0 — see every product listed under this CAS number, including other names
2,6-dichloro-4-(2,4,6-trichlorophenoxy)phenol, 96%, 96% (CAS 90986-10-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147VJ-100mg |
| cas | 90986-10-0 |
| size | 100mg |
| availability | 1.85g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 750.80 Pln | |
| Chemat | 250mg | 1235.60 Pln | |
| Chemat | 500mg | 2128.40 Pln | |
| Chemat | 1g | 3371.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2,6-dichloro-4-(2,4,6-trichlorophenoxy)phenol (CAS 90986-10-0) is a chemical compound with the molecular formula C12H5Cl5O2 and a molecular weight of 358.4 g/mol. IUPAC name: 2,6-dichloro-4-(2,4,6-trichlorophenoxy)phenol. InChIKey: BGNQVNNTALZUMT-UHFFFAOYSA-N.
| Molecular formula | C12H5Cl5O2 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | 2,6-dichloro-4-(2,4,6-trichlorophenoxy)phenol |
| InChIKey | BGNQVNNTALZUMT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)O)Cl)OC2=C(C=C(C=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)