cas: 115250-39-0 — see every product listed under this CAS number, including other names
2-(((1S,2S,3R,4S,5S)-2,3,4-TRIS(BENZYLOXY)-5-((BENZYLOXY)METHYL)-5-HYDROXYCYCLOHEXYL)AMINO)PROPANE-1,3-DIOL, 95+% (CAS 115250-39-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F826457-100MG |
| cas | 115250-39-0 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1528.65 Pln | |
| Fluorochem | 250mg | 2424.16 Pln | |
| Fluorochem | 1g | 4715.02 Pln | |
| Ambeed | 100mg | 1010.06 Pln | |
| Ambeed | 250mg | 1944.56 Pln | |
| Ambeed | 1g | 4748.06 Pln | |
| Ambeed | 5g | 11328.50 Pln | |
| Ambeed | 10g | 18832.31 Pln |
| purity | 95+% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2-[[(1S,2S,3R,4S,5S)-5-hydroxy-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexyl]amino]propane-1,3-diol (CAS 115250-39-0) is a chemical compound with the molecular formula C38H45NO7 and a molecular weight of 627.8 g/mol. IUPAC name: 2-[[(1S,2S,3R,4S,5S)-5-hydroxy-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexyl]amino]propane-1,3-diol. InChIKey: DYSHUNINHUTCLX-ILOBPARPSA-N.
| Molecular formula | C38H45NO7 |
|---|---|
| Molecular weight | 627.8 g/mol |
| IUPAC name | 2-[[(1S,2S,3R,4S,5S)-5-hydroxy-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexyl]amino]propane-1,3-diol |
| InChIKey | DYSHUNINHUTCLX-ILOBPARPSA-N |
| SMILES | C1[C@@H]([C@@H]([C@H]([C@@H]([C@]1(COCC2=CC=CC=C2)O)OCC3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5)NC(CO)CO |
Computed by PubChem (NCBI)