cas: 64489-92-5 — see every product listed under this CAS number, including other names
2-((2-Hydroxynaphthalen-1-yl)methyl)isoindoline-1,3-dione, 97% (CAS 64489-92-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A167314-5g |
| cas | 64489-92-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 2361.52 Pln | |
| AmBeed | 1g | 838.18 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[(2-hydroxynaphthalen-1-yl)methyl]isoindole-1,3-dione (CAS 64489-92-5) is a chemical compound with the molecular formula C19H13NO3 and a molecular weight of 303.3 g/mol. IUPAC name: 2-[(2-hydroxynaphthalen-1-yl)methyl]isoindole-1,3-dione. InChIKey: WJIQLOUOBRNIBE-UHFFFAOYSA-N.
| Molecular formula | C19H13NO3 |
|---|---|
| Molecular weight | 303.3 g/mol |
| IUPAC name | 2-[(2-hydroxynaphthalen-1-yl)methyl]isoindole-1,3-dione |
| InChIKey | WJIQLOUOBRNIBE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2CN3C(=O)C4=CC=CC=C4C3=O)O |
Computed by PubChem (NCBI)